C20H18ClNO3 — CID 4913845
3-[(3-chlorophenyl)methyl]-6,10-dimethyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one (PubChem CID 4913845) has the molecular formula C20H18ClNO3 and a molecular weight of 355.82 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methyl]-6,10-dimethyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one.
| Compound Name | 3-[(3-chlorophenyl)methyl]-6,10-dimethyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one |
|---|---|
| PubChem CID | 4913845 |
| Molecular Formula | C20H18ClNO3 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 3-[(3-chlorophenyl)methyl]-6,10-dimethyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one |
| SMILES | Cc1cc(=O)oc2c(C)c3c(cc12)CN(Cc1cccc(Cl)c1)CO3 |
| InChI | InChI=1S/C20H18ClNO3/c1-12-6-18(23)25-20-13(2)19-15(8-17(12)20)10-22(11-24-19)9-14-4-3-5-16(21)7-14/h3-8H,9-11H2,1-2H3 |
| InChIKey | LMFGDOVVMGUXMK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|