C23H23Cl2NO3 — CID 3692037
6-butyl-3-[(3,4-dichlorophenyl)methyl]-10-methyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one (PubChem CID 3692037) has the molecular formula C23H23Cl2NO3 and a molecular weight of 432.35 g/mol. Its IUPAC name is 6-butyl-3-[(3,4-dichlorophenyl)methyl]-10-methyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one.
| Compound Name | 6-butyl-3-[(3,4-dichlorophenyl)methyl]-10-methyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one |
|---|---|
| PubChem CID | 3692037 |
| Molecular Formula | C23H23Cl2NO3 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 6-butyl-3-[(3,4-dichlorophenyl)methyl]-10-methyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one |
| SMILES | CCCCc1cc(=O)oc2c(C)c3c(cc12)CN(Cc1ccc(Cl)c(Cl)c1)CO3 |
| InChI | InChI=1S/C23H23Cl2NO3/c1-3-4-5-16-10-21(27)29-23-14(2)22-17(9-18(16)23)12-26(13-28-22)11-15-6-7-19(24)20(25)8-15/h6-10H,3-5,11-13H2,1-2H3 |
| InChIKey | CTBDBVGFLAQIMK-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|