C21H19ClFNO3 — CID 3818466
3-(3-chloro-4-fluorophenyl)-10-methyl-6-propyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one (PubChem CID 3818466) has the molecular formula C21H19ClFNO3 and a molecular weight of 387.84 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-10-methyl-6-propyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-10-methyl-6-propyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one |
|---|---|
| PubChem CID | 3818466 |
| Molecular Formula | C21H19ClFNO3 |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-10-methyl-6-propyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one |
| SMILES | CCCc1cc(=O)oc2c(C)c3c(cc12)CN(c1ccc(F)c(Cl)c1)CO3 |
| InChI | InChI=1S/C21H19ClFNO3/c1-3-4-13-8-19(25)27-21-12(2)20-14(7-16(13)21)10-24(11-26-20)15-5-6-18(23)17(22)9-15/h5-9H,3-4,10-11H2,1-2H3 |
| InChIKey | GVGBNVMBCWCQAA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|