C21H17ClF3NO3 — CID 3742678
6-chloro-4-propyl-9-[2-(trifluoromethyl)phenyl]-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 3742678) has the molecular formula C21H17ClF3NO3 and a molecular weight of 423.82 g/mol. Its IUPAC name is 6-chloro-4-propyl-9-[2-(trifluoromethyl)phenyl]-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 6-chloro-4-propyl-9-[2-(trifluoromethyl)phenyl]-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 3742678 |
| Molecular Formula | C21H17ClF3NO3 |
| Molecular Weight | 423.82 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 6-chloro-4-propyl-9-[2-(trifluoromethyl)phenyl]-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | CCCc1cc(=O)oc2c3c(c(Cl)cc12)OCN(c1ccccc1C(F)(F)F)C3 |
| InChI | InChI=1S/C21H17ClF3NO3/c1-2-5-12-8-18(27)29-19-13(12)9-16(22)20-14(19)10-26(11-28-20)17-7-4-3-6-15(17)21(23,24)25/h3-4,6-9H,2,5,10-11H2,1H3 |
| InChIKey | SPGUTJSAMISWAI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.82 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|