C25H28ClNO4 — CID 3727217
9-(3-butoxyphenyl)-4-butyl-6-chloro-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 3727217) has the molecular formula C25H28ClNO4 and a molecular weight of 441.96 g/mol. Its IUPAC name is 9-(3-butoxyphenyl)-4-butyl-6-chloro-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 9-(3-butoxyphenyl)-4-butyl-6-chloro-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 3727217 |
| Molecular Formula | C25H28ClNO4 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 9-(3-butoxyphenyl)-4-butyl-6-chloro-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | CCCCOc1cccc(N2COc3c(Cl)cc4c(CCCC)cc(=O)oc4c3C2)c1 |
| InChI | InChI=1S/C25H28ClNO4/c1-3-5-8-17-12-23(28)31-24-20(17)14-22(26)25-21(24)15-27(16-30-25)18-9-7-10-19(13-18)29-11-6-4-2/h7,9-10,12-14H,3-6,8,11,15-16H2,1-2H3 |
| InChIKey | NYDPCDSXGWDXFF-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|