C25H28ClNO3 — CID 3761355
9-(4-butan-2-ylphenyl)-4-butyl-6-chloro-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 3761355) has the molecular formula C25H28ClNO3 and a molecular weight of 425.96 g/mol. Its IUPAC name is 9-(4-butan-2-ylphenyl)-4-butyl-6-chloro-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 9-(4-butan-2-ylphenyl)-4-butyl-6-chloro-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 3761355 |
| Molecular Formula | C25H28ClNO3 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 9-(4-butan-2-ylphenyl)-4-butyl-6-chloro-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | CCCCc1cc(=O)oc2c3c(c(Cl)cc12)OCN(c1ccc(C(C)CC)cc1)C3 |
| InChI | InChI=1S/C25H28ClNO3/c1-4-6-7-18-12-23(28)30-24-20(18)13-22(26)25-21(24)14-27(15-29-25)19-10-8-17(9-11-19)16(3)5-2/h8-13,16H,4-7,14-15H2,1-3H3 |
| InChIKey | GSYOCGJPUUEZTB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|