C26H28ClNO5 — CID 3823480
butyl 4-(4-butyl-6-chloro-2-oxo-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)benzoate (PubChem CID 3823480) has the molecular formula C26H28ClNO5 and a molecular weight of 469.97 g/mol. Its IUPAC name is butyl 4-(4-butyl-6-chloro-2-oxo-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)benzoate.
| Compound Name | butyl 4-(4-butyl-6-chloro-2-oxo-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)benzoate |
|---|---|
| PubChem CID | 3823480 |
| Molecular Formula | C26H28ClNO5 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | butyl 4-(4-butyl-6-chloro-2-oxo-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2COc3c(Cl)cc4c(CCCC)cc(=O)oc4c3C2)cc1 |
| InChI | InChI=1S/C26H28ClNO5/c1-3-5-7-18-13-23(29)33-24-20(18)14-22(27)25-21(24)15-28(16-32-25)19-10-8-17(9-11-19)26(30)31-12-6-4-2/h8-11,13-14H,3-7,12,15-16H2,1-2H3 |
| InChIKey | JVIRJHHLKDNHSQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|