C25H20ClNO5 — CID 3804253
6-chloro-9-(2,5-dimethoxyphenyl)-4-phenyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 3804253) has the molecular formula C25H20ClNO5 and a molecular weight of 449.89 g/mol. Its IUPAC name is 6-chloro-9-(2,5-dimethoxyphenyl)-4-phenyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 6-chloro-9-(2,5-dimethoxyphenyl)-4-phenyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 3804253 |
| Molecular Formula | C25H20ClNO5 |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 6-chloro-9-(2,5-dimethoxyphenyl)-4-phenyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | COc1ccc(OC)c(N2COc3c(Cl)cc4c(-c5ccccc5)cc(=O)oc4c3C2)c1 |
| InChI | InChI=1S/C25H20ClNO5/c1-29-16-8-9-22(30-2)21(10-16)27-13-19-24-18(11-20(26)25(19)31-14-27)17(12-23(28)32-24)15-6-4-3-5-7-15/h3-12H,13-14H2,1-2H3 |
| InChIKey | JABQHUXWMOOEIX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|