C24H26ClNO4 — CID 3815546
9-(4-butoxyphenyl)-6-chloro-4-propyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 3815546) has the molecular formula C24H26ClNO4 and a molecular weight of 427.93 g/mol. Its IUPAC name is 9-(4-butoxyphenyl)-6-chloro-4-propyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 9-(4-butoxyphenyl)-6-chloro-4-propyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 3815546 |
| Molecular Formula | C24H26ClNO4 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 9-(4-butoxyphenyl)-6-chloro-4-propyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | CCCCOc1ccc(N2COc3c(Cl)cc4c(CCC)cc(=O)oc4c3C2)cc1 |
| InChI | InChI=1S/C24H26ClNO4/c1-3-5-11-28-18-9-7-17(8-10-18)26-14-20-23-19(13-21(25)24(20)29-15-26)16(6-4-2)12-22(27)30-23/h7-10,12-13H,3-6,11,14-15H2,1-2H3 |
| InChIKey | YBZNNKWOANTOFP-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|