C20H16Br2ClNO3 — CID 3848388
6-chloro-9-(2,4-dibromophenyl)-4-propyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 3848388) has the molecular formula C20H16Br2ClNO3 and a molecular weight of 513.61 g/mol. Its IUPAC name is 6-chloro-9-(2,4-dibromophenyl)-4-propyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 6-chloro-9-(2,4-dibromophenyl)-4-propyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 3848388 |
| Molecular Formula | C20H16Br2ClNO3 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 510.92 |
| IUPAC Name | 6-chloro-9-(2,4-dibromophenyl)-4-propyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | CCCc1cc(=O)oc2c3c(c(Cl)cc12)OCN(c1ccc(Br)cc1Br)C3 |
| InChI | InChI=1S/C20H16Br2ClNO3/c1-2-3-11-6-18(25)27-19-13(11)8-16(23)20-14(19)9-24(10-26-20)17-5-4-12(21)7-15(17)22/h4-8H,2-3,9-10H2,1H3 |
| InChIKey | CYSYSGMNMFBANK-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|