C22H19Cl2NO5 — CID 3778848
8-chloro-4-(5-chloro-2,4-dimethoxyphenyl)-6,17-dioxa-4-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-16-one (PubChem CID 3778848) has the molecular formula C22H19Cl2NO5 and a molecular weight of 448.30 g/mol. Its IUPAC name is 8-chloro-4-(5-chloro-2,4-dimethoxyphenyl)-6,17-dioxa-4-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-16-one.
| Compound Name | 8-chloro-4-(5-chloro-2,4-dimethoxyphenyl)-6,17-dioxa-4-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-16-one |
|---|---|
| PubChem CID | 3778848 |
| Molecular Formula | C22H19Cl2NO5 |
| Molecular Weight | 448.30 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 8-chloro-4-(5-chloro-2,4-dimethoxyphenyl)-6,17-dioxa-4-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-16-one |
| SMILES | COc1cc(OC)c(N2COc3c(Cl)cc4c5c(c(=O)oc4c3C2)CCC5)cc1Cl |
| InChI | InChI=1S/C22H19Cl2NO5/c1-27-18-8-19(28-2)17(7-15(18)23)25-9-14-20-13(6-16(24)21(14)29-10-25)11-4-3-5-12(11)22(26)30-20/h6-8H,3-5,9-10H2,1-2H3 |
| InChIKey | OQVURWNCGSQYMN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.30 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|