C22H20ClNO3 — CID 3846808
8-chloro-4-(2,3-dimethylphenyl)-6,17-dioxa-4-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-16-one (PubChem CID 3846808) has the molecular formula C22H20ClNO3 and a molecular weight of 381.86 g/mol. Its IUPAC name is 8-chloro-4-(2,3-dimethylphenyl)-6,17-dioxa-4-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-16-one.
| Compound Name | 8-chloro-4-(2,3-dimethylphenyl)-6,17-dioxa-4-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-16-one |
|---|---|
| PubChem CID | 3846808 |
| Molecular Formula | C22H20ClNO3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 8-chloro-4-(2,3-dimethylphenyl)-6,17-dioxa-4-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-16-one |
| SMILES | Cc1cccc(N2COc3c(Cl)cc4c5c(c(=O)oc4c3C2)CCC5)c1C |
| InChI | InChI=1S/C22H20ClNO3/c1-12-5-3-8-19(13(12)2)24-10-17-20-16(9-18(23)21(17)26-11-24)14-6-4-7-15(14)22(25)27-20/h3,5,8-9H,4,6-7,10-11H2,1-2H3 |
| InChIKey | GDQHLDYHPZLMAA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|