C24H24ClNO4 — CID 2014062
12-chloro-3-[2-(4-methoxyphenyl)ethyl]-2,4,7,8,9,10-hexahydroisochromeno[3,4-f][1,3]benzoxazin-6-one (PubChem CID 2014062) has the molecular formula C24H24ClNO4 and a molecular weight of 425.91 g/mol. Its IUPAC name is 12-chloro-3-[2-(4-methoxyphenyl)ethyl]-2,4,7,8,9,10-hexahydroisochromeno[3,4-f][1,3]benzoxazin-6-one.
| Compound Name | 12-chloro-3-[2-(4-methoxyphenyl)ethyl]-2,4,7,8,9,10-hexahydroisochromeno[3,4-f][1,3]benzoxazin-6-one |
|---|---|
| PubChem CID | 2014062 |
| Molecular Formula | C24H24ClNO4 |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 12-chloro-3-[2-(4-methoxyphenyl)ethyl]-2,4,7,8,9,10-hexahydroisochromeno[3,4-f][1,3]benzoxazin-6-one |
| SMILES | COc1ccc(CCN2COc3c(Cl)cc4c5c(c(=O)oc4c3C2)CCCC5)cc1 |
| InChI | InChI=1S/C24H24ClNO4/c1-28-16-8-6-15(7-9-16)10-11-26-13-20-22-19(12-21(25)23(20)29-14-26)17-4-2-3-5-18(17)24(27)30-22/h6-9,12H,2-5,10-11,13-14H2,1H3 |
| InChIKey | JSEGXZSWCXGALJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|