C20H15BrClNO3 — CID 3729216
4-(4-bromo-2-chlorophenyl)-6,17-dioxa-4-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),8,11(15)-tetraen-16-one (PubChem CID 3729216) has the molecular formula C20H15BrClNO3 and a molecular weight of 432.70 g/mol. Its IUPAC name is 4-(4-bromo-2-chlorophenyl)-6,17-dioxa-4-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),8,11(15)-tetraen-16-one.
| Compound Name | 4-(4-bromo-2-chlorophenyl)-6,17-dioxa-4-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),8,11(15)-tetraen-16-one |
|---|---|
| PubChem CID | 3729216 |
| Molecular Formula | C20H15BrClNO3 |
| Molecular Weight | 432.70 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | 4-(4-bromo-2-chlorophenyl)-6,17-dioxa-4-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),8,11(15)-tetraen-16-one |
| SMILES | O=c1oc2c3c(ccc2c2c1CCC2)OCN(c1ccc(Br)cc1Cl)C3 |
| InChI | InChI=1S/C20H15BrClNO3/c21-11-4-6-17(16(22)8-11)23-9-15-18(25-10-23)7-5-13-12-2-1-3-14(12)20(24)26-19(13)15/h4-8H,1-3,9-10H2 |
| InChIKey | GLXGOUVXOPGBRD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.70 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|