C21H18ClNO5 — CID 3814913
methyl 2-(6-chloro-4-ethyl-2-oxo-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)benzoate (PubChem CID 3814913) has the molecular formula C21H18ClNO5 and a molecular weight of 399.83 g/mol. Its IUPAC name is methyl 2-(6-chloro-4-ethyl-2-oxo-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)benzoate.
| Compound Name | methyl 2-(6-chloro-4-ethyl-2-oxo-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)benzoate |
|---|---|
| PubChem CID | 3814913 |
| Molecular Formula | C21H18ClNO5 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | methyl 2-(6-chloro-4-ethyl-2-oxo-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)benzoate |
| SMILES | CCc1cc(=O)oc2c3c(c(Cl)cc12)OCN(c1ccccc1C(=O)OC)C3 |
| InChI | InChI=1S/C21H18ClNO5/c1-3-12-8-18(24)28-19-14(12)9-16(22)20-15(19)10-23(11-27-20)17-7-5-4-6-13(17)21(25)26-2/h4-9H,3,10-11H2,1-2H3 |
| InChIKey | PGTRSLGBKFVZRU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|