C24H18O5 — CID 978425
(2R)-2-(8-methyl-2-oxo-4-phenylchromen-7-yl)oxy-2-phenylacetic acid (PubChem CID 978425) has the molecular formula C24H18O5 and a molecular weight of 386.40 g/mol. Its IUPAC name is (2R)-2-(8-methyl-2-oxo-4-phenylchromen-7-yl)oxy-2-phenylacetic acid.
| Compound Name | (2R)-2-(8-methyl-2-oxo-4-phenylchromen-7-yl)oxy-2-phenylacetic acid |
|---|---|
| PubChem CID | 978425 |
| Molecular Formula | C24H18O5 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | (2R)-2-(8-methyl-2-oxo-4-phenylchromen-7-yl)oxy-2-phenylacetic acid |
| SMILES | Cc1c(O[C@@H](C(=O)O)c2ccccc2)ccc2c(-c3ccccc3)cc(=O)oc12 |
| InChI | InChI=1S/C24H18O5/c1-15-20(28-23(24(26)27)17-10-6-3-7-11-17)13-12-18-19(14-21(25)29-22(15)18)16-8-4-2-5-9-16/h2-14,23H,1H3,(H,26,27)/t23-/m1/s1 |
| InChIKey | BGEVOTWGOHBDHG-HSZRJFAPSA-N |
| XLogP | 4.97 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|