C26H29NO6 — CID 5196804
(8-methyl-2-oxo-4-phenylchromen-7-yl) 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 5196804) has the molecular formula C26H29NO6 and a molecular weight of 451.52 g/mol. Its IUPAC name is (8-methyl-2-oxo-4-phenylchromen-7-yl) 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | (8-methyl-2-oxo-4-phenylchromen-7-yl) 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 5196804 |
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | (8-methyl-2-oxo-4-phenylchromen-7-yl) 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | Cc1c(OC(=O)C(NC(=O)OC(C)(C)C)C(C)C)ccc2c(-c3ccccc3)cc(=O)oc12 |
| InChI | InChI=1S/C26H29NO6/c1-15(2)22(27-25(30)33-26(4,5)6)24(29)31-20-13-12-18-19(17-10-8-7-9-11-17)14-21(28)32-23(18)16(20)3/h7-15,22H,1-6H3,(H,27,30) |
| InChIKey | OXNIERKEZVXOAL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|