C21H27NO6S — CID 3795924
(4,8-dimethyl-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate (PubChem CID 3795924) has the molecular formula C21H27NO6S and a molecular weight of 421.52 g/mol. Its IUPAC name is (4,8-dimethyl-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate.
| Compound Name | (4,8-dimethyl-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 3795924 |
| Molecular Formula | C21H27NO6S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | (4,8-dimethyl-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NC(=O)OC(C)(C)C)C(=O)Oc1ccc2c(C)cc(=O)oc2c1C |
| InChI | InChI=1S/C21H27NO6S/c1-12-11-17(23)27-18-13(2)16(8-7-14(12)18)26-19(24)15(9-10-29-6)22-20(25)28-21(3,4)5/h7-8,11,15H,9-10H2,1-6H3,(H,22,25) |
| InChIKey | BWDGZFMVZRVRPZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|