C25H35NO6 — CID 3725541
(4-butyl-8-methyl-2-oxochromen-7-yl) 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 3725541) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is (4-butyl-8-methyl-2-oxochromen-7-yl) 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | (4-butyl-8-methyl-2-oxochromen-7-yl) 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 3725541 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | (4-butyl-8-methyl-2-oxochromen-7-yl) 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CCCCc1cc(=O)oc2c(C)c(OC(=O)C(CC(C)C)NC(=O)OC(C)(C)C)ccc12 |
| InChI | InChI=1S/C25H35NO6/c1-8-9-10-17-14-21(27)31-22-16(4)20(12-11-18(17)22)30-23(28)19(13-15(2)3)26-24(29)32-25(5,6)7/h11-12,14-15,19H,8-10,13H2,1-7H3,(H,26,29) |
| InChIKey | PSWOYKKYSOAVFZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|