C25H33NO6 — CID 4909620
1-O-tert-butyl 4-O-(4-butyl-8-methyl-2-oxochromen-7-yl) piperidine-1,4-dicarboxylate (PubChem CID 4909620) has the molecular formula C25H33NO6 and a molecular weight of 443.54 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-(4-butyl-8-methyl-2-oxochromen-7-yl) piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-(4-butyl-8-methyl-2-oxochromen-7-yl) piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 4909620 |
| Molecular Formula | C25H33NO6 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 1-O-tert-butyl 4-O-(4-butyl-8-methyl-2-oxochromen-7-yl) piperidine-1,4-dicarboxylate |
| SMILES | CCCCc1cc(=O)oc2c(C)c(OC(=O)C3CCN(C(=O)OC(C)(C)C)CC3)ccc12 |
| InChI | InChI=1S/C25H33NO6/c1-6-7-8-18-15-21(27)31-22-16(2)20(10-9-19(18)22)30-23(28)17-11-13-26(14-12-17)24(29)32-25(3,4)5/h9-10,15,17H,6-8,11-14H2,1-5H3 |
| InChIKey | GNVLITCQSAQWHO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|