C25H31NO6 — CID 4910044
1-O-tert-butyl 4-O-(3-methyl-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl) piperidine-1,4-dicarboxylate (PubChem CID 4910044) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-(3-methyl-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl) piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-(3-methyl-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl) piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 4910044 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 1-O-tert-butyl 4-O-(3-methyl-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl) piperidine-1,4-dicarboxylate |
| SMILES | Cc1cc(OC(=O)C2CCN(C(=O)OC(C)(C)C)CC2)c2c3c(c(=O)oc2c1)CCCC3 |
| InChI | InChI=1S/C25H31NO6/c1-15-13-19(21-17-7-5-6-8-18(17)23(28)31-20(21)14-15)30-22(27)16-9-11-26(12-10-16)24(29)32-25(2,3)4/h13-14,16H,5-12H2,1-4H3 |
| InChIKey | JOEIMPLWKHJURK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|