C23H21NO6 — CID 6351933
(2R)-2-[[2-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]acetyl]amino]-2-phenylacetic acid (PubChem CID 6351933) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is (2R)-2-[[2-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]acetyl]amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[[2-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]acetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 6351933 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (2R)-2-[[2-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]acetyl]amino]-2-phenylacetic acid |
| SMILES | Cc1cc(OCC(=O)N[C@@H](C(=O)O)c2ccccc2)c2c3c(c(=O)oc2c1)CCC3 |
| InChI | InChI=1S/C23H21NO6/c1-13-10-17(20-15-8-5-9-16(15)23(28)30-18(20)11-13)29-12-19(25)24-21(22(26)27)14-6-3-2-4-7-14/h2-4,6-7,10-11,21H,5,8-9,12H2,1H3,(H,24,25)(H,26,27)/t21-/m1/s1 |
| InChIKey | KTXGWIJAWIQNSQ-OAQYLSRUSA-N |
| XLogP | 2.91 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|