C30H27NO6 — CID 6568167
(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl) (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 6568167) has the molecular formula C30H27NO6 and a molecular weight of 497.55 g/mol. Its IUPAC name is (7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl) (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | (7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl) (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 6568167 |
| Molecular Formula | C30H27NO6 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | (7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl) (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | Cc1cc(OC(=O)[C@@H](Cc2ccccc2)NC(=O)OCc2ccccc2)c2c3c(c(=O)oc2c1)CCC3 |
| InChI | InChI=1S/C30H27NO6/c1-19-15-25-27(22-13-8-14-23(22)28(32)36-25)26(16-19)37-29(33)24(17-20-9-4-2-5-10-20)31-30(34)35-18-21-11-6-3-7-12-21/h2-7,9-12,15-16,24H,8,13-14,17-18H2,1H3,(H,31,34)/t24-/m1/s1 |
| InChIKey | WJDVYRYAOKQEIX-XMMPIXPASA-N |
| XLogP | 5.03 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|