C28H33NO6 — CID 40911242
(4-butyl-7-methyl-2-oxochromen-5-yl) (2R)-2-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 40911242) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is (4-butyl-7-methyl-2-oxochromen-5-yl) (2R)-2-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | (4-butyl-7-methyl-2-oxochromen-5-yl) (2R)-2-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 40911242 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | (4-butyl-7-methyl-2-oxochromen-5-yl) (2R)-2-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CCCCc1cc(=O)oc2cc(C)cc(OC(=O)[C@@H](CCCC)NC(=O)OCc3ccccc3)c12 |
| InChI | InChI=1S/C28H33NO6/c1-4-6-13-21-17-25(30)34-23-15-19(3)16-24(26(21)23)35-27(31)22(14-7-5-2)29-28(32)33-18-20-11-9-8-10-12-20/h8-12,15-17,22H,4-7,13-14,18H2,1-3H3,(H,29,32)/t22-/m1/s1 |
| InChIKey | MAXWSXGBXBHWCQ-JOCHJYFZSA-N |
| XLogP | 5.83 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|