C22H20N2O5 — CID 4893603
2-[[2-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]acetyl]amino]benzamide (PubChem CID 4893603) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-[[2-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]acetyl]amino]benzamide.
| Compound Name | 2-[[2-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 4893603 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-[[2-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]acetyl]amino]benzamide |
| SMILES | Cc1cc(OCC(=O)Nc2ccccc2C(N)=O)c2c3c(c(=O)oc2c1)CCC3 |
| InChI | InChI=1S/C22H20N2O5/c1-12-9-17(20-13-6-4-7-14(13)22(27)29-18(20)10-12)28-11-19(25)24-16-8-3-2-5-15(16)21(23)26/h2-3,5,8-10H,4,6-7,11H2,1H3,(H2,23,26)(H,24,25) |
| InChIKey | CTPNAZZVUUROSL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|