C24H31NO4 — CID 11904745
N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-2-[(3-methyl-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl)oxy]acetamide (PubChem CID 11904745) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-2-[(3-methyl-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl)oxy]acetamide.
| Compound Name | N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-2-[(3-methyl-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl)oxy]acetamide |
|---|---|
| PubChem CID | 11904745 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-2-[(3-methyl-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl)oxy]acetamide |
| SMILES | Cc1cc(OCC(=O)N[C@@H]2CCC[C@H](C)[C@@H]2C)c2c3c(c(=O)oc2c1)CCCC3 |
| InChI | InChI=1S/C24H31NO4/c1-14-11-20(28-13-22(26)25-19-10-6-7-15(2)16(19)3)23-17-8-4-5-9-18(17)24(27)29-21(23)12-14/h11-12,15-16,19H,4-10,13H2,1-3H3,(H,25,26)/t15-,16-,19+/m0/s1 |
| InChIKey | OYGUJLIEXIRPHU-TXPKVOOTSA-N |
| XLogP | 4.30 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|