C21H16Cl3NO4 — CID 3833014
2-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 3833014) has the molecular formula C21H16Cl3NO4 and a molecular weight of 452.72 g/mol. Its IUPAC name is 2-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 3833014 |
| Molecular Formula | C21H16Cl3NO4 |
| Molecular Weight | 452.72 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | 2-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | Cc1cc(OCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)c2c3c(c(=O)oc2c1)CCC3 |
| InChI | InChI=1S/C21H16Cl3NO4/c1-10-5-17(20-11-3-2-4-12(11)21(27)29-18(20)6-10)28-9-19(26)25-16-8-14(23)13(22)7-15(16)24/h5-8H,2-4,9H2,1H3,(H,25,26) |
| InChIKey | MPMBQLWAWDBEPD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.72 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|