C17H19F4NO4 — CID 87996475
1-O-tert-butyl 4-O-(2,3,4,5-tetrafluorophenyl) piperidine-1,4-dicarboxylate (PubChem CID 87996475) has the molecular formula C17H19F4NO4 and a molecular weight of 377.33 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-(2,3,4,5-tetrafluorophenyl) piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-(2,3,4,5-tetrafluorophenyl) piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 87996475 |
| Molecular Formula | C17H19F4NO4 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 1-O-tert-butyl 4-O-(2,3,4,5-tetrafluorophenyl) piperidine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)Oc2cc(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C17H19F4NO4/c1-17(2,3)26-16(24)22-6-4-9(5-7-22)15(23)25-11-8-10(18)12(19)14(21)13(11)20/h8-9H,4-7H2,1-3H3 |
| InChIKey | DJCIZJKUMCESHE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|