C18H21F4NO3 — CID 58817540
tert-butyl 4-[2-fluoro-3-(trifluoromethyl)benzoyl]piperidine-1-carboxylate (PubChem CID 58817540) has the molecular formula C18H21F4NO3 and a molecular weight of 375.36 g/mol. Its IUPAC name is tert-butyl 4-[2-fluoro-3-(trifluoromethyl)benzoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-fluoro-3-(trifluoromethyl)benzoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58817540 |
| Molecular Formula | C18H21F4NO3 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | tert-butyl 4-[2-fluoro-3-(trifluoromethyl)benzoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)c2cccc(C(F)(F)F)c2F)CC1 |
| InChI | InChI=1S/C18H21F4NO3/c1-17(2,3)26-16(25)23-9-7-11(8-10-23)15(24)12-5-4-6-13(14(12)19)18(20,21)22/h4-6,11H,7-10H2,1-3H3 |
| InChIKey | MZIIHIAVKATWQV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |