C13H13F4NO2 — CID 79885733
[2-fluoro-3-(trifluoromethyl)phenyl]-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 79885733) has the molecular formula C13H13F4NO2 and a molecular weight of 291.24 g/mol. Its IUPAC name is [2-fluoro-3-(trifluoromethyl)phenyl]-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | [2-fluoro-3-(trifluoromethyl)phenyl]-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 79885733 |
| Molecular Formula | C13H13F4NO2 |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | [2-fluoro-3-(trifluoromethyl)phenyl]-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1F)N1CCC(O)CC1 |
| InChI | InChI=1S/C13H13F4NO2/c14-11-9(2-1-3-10(11)13(15,16)17)12(20)18-6-4-8(19)5-7-18/h1-3,8,19H,4-7H2 |
| InChIKey | DVABUBLYLPVSOY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |