C17H20F4N2O — CID 119999427
[2-fluoro-3-(trifluoromethyl)phenyl]-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone (PubChem CID 119999427) has the molecular formula C17H20F4N2O and a molecular weight of 344.35 g/mol. Its IUPAC name is [2-fluoro-3-(trifluoromethyl)phenyl]-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone.
| Compound Name | [2-fluoro-3-(trifluoromethyl)phenyl]-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 119999427 |
| Molecular Formula | C17H20F4N2O |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | [2-fluoro-3-(trifluoromethyl)phenyl]-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1F)N1CCC(C2CCCN2)CC1 |
| InChI | InChI=1S/C17H20F4N2O/c18-15-12(3-1-4-13(15)17(19,20)21)16(24)23-9-6-11(7-10-23)14-5-2-8-22-14/h1,3-4,11,14,22H,2,5-10H2 |
| InChIKey | VPWMEAGTTMAAHX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |