C16H22ClIN2O — CID 119999409
(2-iodophenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone;hydrochloride (PubChem CID 119999409) has the molecular formula C16H22ClIN2O and a molecular weight of 420.72 g/mol. Its IUPAC name is (2-iodophenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone;hydrochloride.
| Compound Name | (2-iodophenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119999409 |
| Molecular Formula | C16H22ClIN2O |
| Molecular Weight | 420.72 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | (2-iodophenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccccc1I)N1CCC(C2CCCN2)CC1 |
| InChI | InChI=1S/C16H21IN2O.ClH/c17-14-5-2-1-4-13(14)16(20)19-10-7-12(8-11-19)15-6-3-9-18-15;/h1-2,4-5,12,15,18H,3,6-11H2;1H |
| InChIKey | HYHSKBNYIGZMDP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.72 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|