C16H21BrCl2N2O — CID 119999531
(4-bromo-2-chlorophenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone;hydrochloride (PubChem CID 119999531) has the molecular formula C16H21BrCl2N2O and a molecular weight of 408.17 g/mol. Its IUPAC name is (4-bromo-2-chlorophenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone;hydrochloride.
| Compound Name | (4-bromo-2-chlorophenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119999531 |
| Molecular Formula | C16H21BrCl2N2O |
| Molecular Weight | 408.17 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | (4-bromo-2-chlorophenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(Br)cc1Cl)N1CCC(C2CCCN2)CC1 |
| InChI | InChI=1S/C16H20BrClN2O.ClH/c17-12-3-4-13(14(18)10-12)16(21)20-8-5-11(6-9-20)15-2-1-7-19-15;/h3-4,10-11,15,19H,1-2,5-9H2;1H |
| InChIKey | AFOYXVHIYNCBML-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.17 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |