C18H26N2O3 — CID 119999763
(2,4-dimethoxyphenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone (PubChem CID 119999763) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone.
| Compound Name | (2,4-dimethoxyphenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 119999763 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (2,4-dimethoxyphenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone |
| SMILES | COc1ccc(C(=O)N2CCC(C3CCCN3)CC2)c(OC)c1 |
| InChI | InChI=1S/C18H26N2O3/c1-22-14-5-6-15(17(12-14)23-2)18(21)20-10-7-13(8-11-20)16-4-3-9-19-16/h5-6,12-13,16,19H,3-4,7-11H2,1-2H3 |
| InChIKey | NEILGNVZRAOUTH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |