C17H24ClFN2O2 — CID 119999724
(2-fluoro-6-methoxyphenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone;hydrochloride (PubChem CID 119999724) has the molecular formula C17H24ClFN2O2 and a molecular weight of 342.84 g/mol. Its IUPAC name is (2-fluoro-6-methoxyphenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone;hydrochloride.
| Compound Name | (2-fluoro-6-methoxyphenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119999724 |
| Molecular Formula | C17H24ClFN2O2 |
| Molecular Weight | 342.84 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (2-fluoro-6-methoxyphenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone;hydrochloride |
| SMILES | COc1cccc(F)c1C(=O)N1CCC(C2CCCN2)CC1.Cl |
| InChI | InChI=1S/C17H23FN2O2.ClH/c1-22-15-6-2-4-13(18)16(15)17(21)20-10-7-12(8-11-20)14-5-3-9-19-14;/h2,4,6,12,14,19H,3,5,7-11H2,1H3;1H |
| InChIKey | HGVCMQLXRZQNOB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.84 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |