C16H20BrClN2O — CID 81294449
(4-bromo-3-chlorophenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone (PubChem CID 81294449) has the molecular formula C16H20BrClN2O and a molecular weight of 371.71 g/mol. Its IUPAC name is (4-bromo-3-chlorophenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone.
| Compound Name | (4-bromo-3-chlorophenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 81294449 |
| Molecular Formula | C16H20BrClN2O |
| Molecular Weight | 371.71 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | (4-bromo-3-chlorophenyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1ccc(Br)c(Cl)c1)N1CCC(C2CCCN2)CC1 |
| InChI | InChI=1S/C16H20BrClN2O/c17-13-4-3-12(10-14(13)18)16(21)20-8-5-11(6-9-20)15-2-1-7-19-15/h3-4,10-11,15,19H,1-2,5-9H2 |
| InChIKey | QTGYEADQRWULDK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.71 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |