C16H21ClF4N2O2 — CID 86778691
[4-(3-aminopropoxy)piperidin-1-yl]-[2-fluoro-3-(trifluoromethyl)phenyl]methanone;hydrochloride (PubChem CID 86778691) has the molecular formula C16H21ClF4N2O2 and a molecular weight of 384.80 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[2-fluoro-3-(trifluoromethyl)phenyl]methanone;hydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[2-fluoro-3-(trifluoromethyl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 86778691 |
| Molecular Formula | C16H21ClF4N2O2 |
| Molecular Weight | 384.80 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[2-fluoro-3-(trifluoromethyl)phenyl]methanone;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)c2cccc(C(F)(F)F)c2F)CC1 |
| InChI | InChI=1S/C16H20F4N2O2.ClH/c17-14-12(3-1-4-13(14)16(18,19)20)15(23)22-8-5-11(6-9-22)24-10-2-7-21;/h1,3-4,11H,2,5-10,21H2;1H |
| InChIKey | HVGRGUWKXMTWAT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.80 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|