C21H27ClN2O3 — CID 119662357
[4-(3-aminopropoxy)piperidin-1-yl]-(2-phenoxyphenyl)methanone;hydrochloride (PubChem CID 119662357) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(2-phenoxyphenyl)methanone;hydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(2-phenoxyphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119662357 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(2-phenoxyphenyl)methanone;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)c2ccccc2Oc2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N2O3.ClH/c22-13-6-16-25-17-11-14-23(15-12-17)21(24)19-9-4-5-10-20(19)26-18-7-2-1-3-8-18;/h1-5,7-10,17H,6,11-16,22H2;1H |
| InChIKey | QVEYNGQXJNBTLU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|