C20H27Cl2N3O3 — CID 119663527
[4-(3-aminopropoxy)piperidin-1-yl]-(4-phenoxy-2-pyridinyl)methanone;dihydrochloride (PubChem CID 119663527) has the molecular formula C20H27Cl2N3O3 and a molecular weight of 428.36 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(4-phenoxy-2-pyridinyl)methanone;dihydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(4-phenoxy-2-pyridinyl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119663527 |
| Molecular Formula | C20H27Cl2N3O3 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(4-phenoxy-2-pyridinyl)methanone;dihydrochloride |
| SMILES | Cl.Cl.NCCCOC1CCN(C(=O)c2cc(Oc3ccccc3)ccn2)CC1 |
| InChI | InChI=1S/C20H25N3O3.2ClH/c21-10-4-14-25-16-8-12-23(13-9-16)20(24)19-15-18(7-11-22-19)26-17-5-2-1-3-6-17;;/h1-3,5-7,11,15-16H,4,8-10,12-14,21H2;2*1H |
| InChIKey | WLWYWTFYRVVNGT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|