C14H22Cl3N3O2 — CID 119663041
[4-(3-aminopropoxy)piperidin-1-yl]-(5-chloro-2-pyridinyl)methanone;dihydrochloride (PubChem CID 119663041) has the molecular formula C14H22Cl3N3O2 and a molecular weight of 370.71 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(5-chloro-2-pyridinyl)methanone;dihydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(5-chloro-2-pyridinyl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119663041 |
| Molecular Formula | C14H22Cl3N3O2 |
| Molecular Weight | 370.71 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(5-chloro-2-pyridinyl)methanone;dihydrochloride |
| SMILES | Cl.Cl.NCCCOC1CCN(C(=O)c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C14H20ClN3O2.2ClH/c15-11-2-3-13(17-10-11)14(19)18-7-4-12(5-8-18)20-9-1-6-16;;/h2-3,10,12H,1,4-9,16H2;2*1H |
| InChIKey | AUXLQANFODGRKP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.71 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|