C20H24ClN3O2 — CID 119663953
[4-(3-aminopropoxy)piperidin-1-yl]-[5-(4-chlorophenyl)-3-pyridinyl]methanone (PubChem CID 119663953) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[5-(4-chlorophenyl)-3-pyridinyl]methanone.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[5-(4-chlorophenyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 119663953 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[5-(4-chlorophenyl)-3-pyridinyl]methanone |
| SMILES | NCCCOC1CCN(C(=O)c2cncc(-c3ccc(Cl)cc3)c2)CC1 |
| InChI | InChI=1S/C20H24ClN3O2/c21-18-4-2-15(3-5-18)16-12-17(14-23-13-16)20(25)24-9-6-19(7-10-24)26-11-1-8-22/h2-5,12-14,19H,1,6-11,22H2 |
| InChIKey | LJYIZBFTVQOBQD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|