C16H15ClN2O — CID 42845797
[5-(4-chlorophenyl)-3-pyridinyl]-pyrrolidin-1-ylmethanone (PubChem CID 42845797) has the molecular formula C16H15ClN2O and a molecular weight of 286.76 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-3-pyridinyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-(4-chlorophenyl)-3-pyridinyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 42845797 |
| Molecular Formula | C16H15ClN2O |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | [5-(4-chlorophenyl)-3-pyridinyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cncc(-c2ccc(Cl)cc2)c1)N1CCCC1 |
| InChI | InChI=1S/C16H15ClN2O/c17-15-5-3-12(4-6-15)13-9-14(11-18-10-13)16(20)19-7-1-2-8-19/h3-6,9-11H,1-2,7-8H2 |
| InChIKey | BKIJGROEWKOTMI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |