C17H16ClN3O2 — CID 109102585
N-(4-chlorophenyl)-5-(pyrrolidine-1-carbonyl)pyridine-3-carboxamide (PubChem CID 109102585) has the molecular formula C17H16ClN3O2 and a molecular weight of 329.79 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5-(pyrrolidine-1-carbonyl)pyridine-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-5-(pyrrolidine-1-carbonyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109102585 |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-(4-chlorophenyl)-5-(pyrrolidine-1-carbonyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cncc(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C17H16ClN3O2/c18-14-3-5-15(6-4-14)20-16(22)12-9-13(11-19-10-12)17(23)21-7-1-2-8-21/h3-6,9-11H,1-2,7-8H2,(H,20,22) |
| InChIKey | CMXAXGIRWSEXGQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |