C19H20ClN3O2 — CID 109103238
N-(4-chlorophenyl)-5-(4-methylpiperidine-1-carbonyl)pyridine-3-carboxamide (PubChem CID 109103238) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5-(4-methylpiperidine-1-carbonyl)pyridine-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-5-(4-methylpiperidine-1-carbonyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109103238 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-(4-chlorophenyl)-5-(4-methylpiperidine-1-carbonyl)pyridine-3-carboxamide |
| SMILES | CC1CCN(C(=O)c2cncc(C(=O)Nc3ccc(Cl)cc3)c2)CC1 |
| InChI | InChI=1S/C19H20ClN3O2/c1-13-6-8-23(9-7-13)19(25)15-10-14(11-21-12-15)18(24)22-17-4-2-16(20)3-5-17/h2-5,10-13H,6-9H2,1H3,(H,22,24) |
| InChIKey | WCKTWGFZKOUDAJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |