C18H22ClN3O2S — CID 119662666
[4-(3-aminopropoxy)piperidin-1-yl]-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methanone (PubChem CID 119662666) has the molecular formula C18H22ClN3O2S and a molecular weight of 379.91 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methanone.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 119662666 |
| Molecular Formula | C18H22ClN3O2S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methanone |
| SMILES | NCCCOC1CCN(C(=O)c2csc(-c3ccccc3Cl)n2)CC1 |
| InChI | InChI=1S/C18H22ClN3O2S/c19-15-5-2-1-4-14(15)17-21-16(12-25-17)18(23)22-9-6-13(7-10-22)24-11-3-8-20/h1-2,4-5,12-13H,3,6-11,20H2 |
| InChIKey | LUYHIIHEFFFMTC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|