C20H27N3O3S — CID 119661713
[4-(3-aminopropoxy)piperidin-1-yl]-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]methanone (PubChem CID 119661713) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]methanone.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 119661713 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]methanone |
| SMILES | CCOc1ccc(-c2nc(C(=O)N3CCC(OCCCN)CC3)cs2)cc1 |
| InChI | InChI=1S/C20H27N3O3S/c1-2-25-16-6-4-15(5-7-16)19-22-18(14-27-19)20(24)23-11-8-17(9-12-23)26-13-3-10-21/h4-7,14,17H,2-3,8-13,21H2,1H3 |
| InChIKey | KDTJYCBUFJIGGC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|