C22H26N4O5S — CID 55615545
1-[4-[2-(4-ethoxyphenyl)-1,3-thiazole-4-carbonyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione (PubChem CID 55615545) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is 1-[4-[2-(4-ethoxyphenyl)-1,3-thiazole-4-carbonyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione.
| Compound Name | 1-[4-[2-(4-ethoxyphenyl)-1,3-thiazole-4-carbonyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione |
|---|---|
| PubChem CID | 55615545 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 1-[4-[2-(4-ethoxyphenyl)-1,3-thiazole-4-carbonyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione |
| SMILES | CCOc1ccc(-c2nc(C(=O)N3CCN(C(=O)C(=O)N4CCOCC4)CC3)cs2)cc1 |
| InChI | InChI=1S/C22H26N4O5S/c1-2-31-17-5-3-16(4-6-17)19-23-18(15-32-19)20(27)24-7-9-25(10-8-24)21(28)22(29)26-11-13-30-14-12-26/h3-6,15H,2,7-14H2,1H3 |
| InChIKey | OWIXATRQSBBLBD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 92.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|