C18H23ClN4O2 — CID 119664349
[4-(3-aminopropoxy)piperidin-1-yl]-[5-(2-chlorophenyl)-1H-pyrazol-4-yl]methanone (PubChem CID 119664349) has the molecular formula C18H23ClN4O2 and a molecular weight of 362.86 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[5-(2-chlorophenyl)-1H-pyrazol-4-yl]methanone.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[5-(2-chlorophenyl)-1H-pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 119664349 |
| Molecular Formula | C18H23ClN4O2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[5-(2-chlorophenyl)-1H-pyrazol-4-yl]methanone |
| SMILES | NCCCOC1CCN(C(=O)c2cn[nH]c2-c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H23ClN4O2/c19-16-5-2-1-4-14(16)17-15(12-21-22-17)18(24)23-9-6-13(7-10-23)25-11-3-8-20/h1-2,4-5,12-13H,3,6-11,20H2,(H,21,22) |
| InChIKey | ZDQQDTVZAIKIOP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|