C19H26Cl2N4O2 — CID 119662673
[4-(3-aminopropoxy)piperidin-1-yl]-[1-(2-chlorophenyl)-5-methylpyrazol-4-yl]methanone;hydrochloride (PubChem CID 119662673) has the molecular formula C19H26Cl2N4O2 and a molecular weight of 413.35 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[1-(2-chlorophenyl)-5-methylpyrazol-4-yl]methanone;hydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[1-(2-chlorophenyl)-5-methylpyrazol-4-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119662673 |
| Molecular Formula | C19H26Cl2N4O2 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[1-(2-chlorophenyl)-5-methylpyrazol-4-yl]methanone;hydrochloride |
| SMILES | Cc1c(C(=O)N2CCC(OCCCN)CC2)cnn1-c1ccccc1Cl.Cl |
| InChI | InChI=1S/C19H25ClN4O2.ClH/c1-14-16(13-22-24(14)18-6-3-2-5-17(18)20)19(25)23-10-7-15(8-11-23)26-12-4-9-21;/h2-3,5-6,13,15H,4,7-12,21H2,1H3;1H |
| InChIKey | YKMCTHJLRPCCGG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|