C17H21ClN4O2 — CID 111758263
[1-(2-chlorophenyl)-5-methylpyrazol-4-yl]-[4-(2-hydroxyethyl)piperazin-1-yl]methanone (PubChem CID 111758263) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is [1-(2-chlorophenyl)-5-methylpyrazol-4-yl]-[4-(2-hydroxyethyl)piperazin-1-yl]methanone.
| Compound Name | [1-(2-chlorophenyl)-5-methylpyrazol-4-yl]-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 111758263 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [1-(2-chlorophenyl)-5-methylpyrazol-4-yl]-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCN(CCO)CC2)cnn1-c1ccccc1Cl |
| InChI | InChI=1S/C17H21ClN4O2/c1-13-14(12-19-22(13)16-5-3-2-4-15(16)18)17(24)21-8-6-20(7-9-21)10-11-23/h2-5,12,23H,6-11H2,1H3 |
| InChIKey | MMOPUCOBCPERDH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |